C9H14N6O2 — CID 112735699
N-(2-amino-1-cyclopropyl-2-hydroxyiminoethyl)-2-methyltriazole-4-carboxamide (PubChem CID 112735699) has the molecular formula C9H14N6O2 and a molecular weight of 238.25 g/mol. Its IUPAC name is N-(2-amino-1-cyclopropyl-2-hydroxyiminoethyl)-2-methyltriazole-4-carboxamide.
| Compound Name | N-(2-amino-1-cyclopropyl-2-hydroxyiminoethyl)-2-methyltriazole-4-carboxamide |
|---|---|
| PubChem CID | 112735699 |
| Molecular Formula | C9H14N6O2 |
| Molecular Weight | 238.25 g/mol |
| Exact Mass | 238.12 |
| IUPAC Name | N-(2-amino-1-cyclopropyl-2-hydroxyiminoethyl)-2-methyltriazole-4-carboxamide |
| SMILES | Cn1ncc(C(=O)NC(C(N)=NO)C2CC2)n1 |
| InChI | InChI=1S/C9H14N6O2/c1-15-11-4-6(13-15)9(16)12-7(5-2-3-5)8(10)14-17/h4-5,7,17H,2-3H2,1H3,(H2,10,14)(H,12,16) |
| InChIKey | CGIOQVCCNQMHSZ-UHFFFAOYSA-N |
| XLogP | -0.93 |
| TPSA | 118.42 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 238.25 |
| LogP ≤ 5 | -0.93 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|