C12H8Cl2N2O2S — CID 112736320
5-amino-6-(3,5-dichlorophenyl)sulfanylpyridine-2-carboxylic acid (PubChem CID 112736320) has the molecular formula C12H8Cl2N2O2S and a molecular weight of 315.18 g/mol. Its IUPAC name is 5-amino-6-(3,5-dichlorophenyl)sulfanylpyridine-2-carboxylic acid.
| Compound Name | 5-amino-6-(3,5-dichlorophenyl)sulfanylpyridine-2-carboxylic acid |
|---|---|
| PubChem CID | 112736320 |
| Molecular Formula | C12H8Cl2N2O2S |
| Molecular Weight | 315.18 g/mol |
| Exact Mass | 313.97 |
| IUPAC Name | 5-amino-6-(3,5-dichlorophenyl)sulfanylpyridine-2-carboxylic acid |
| SMILES | Nc1ccc(C(=O)O)nc1Sc1cc(Cl)cc(Cl)c1 |
| InChI | InChI=1S/C12H8Cl2N2O2S/c13-6-3-7(14)5-8(4-6)19-11-9(15)1-2-10(16-11)12(17)18/h1-5H,15H2,(H,17,18) |
| InChIKey | OIXQDHZNCWVSKW-UHFFFAOYSA-N |
| XLogP | 3.82 |
| TPSA | 76.21 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 315.18 |
| LogP ≤ 5 | 3.82 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |