C10H8F3NO4 — CID 112736689
(4-hydroxy-1,2-oxazolidin-2-yl)-(2,4,5-trifluoro-3-hydroxyphenyl)methanone (PubChem CID 112736689) has the molecular formula C10H8F3NO4 and a molecular weight of 263.17 g/mol. Its IUPAC name is (4-hydroxy-1,2-oxazolidin-2-yl)-(2,4,5-trifluoro-3-hydroxyphenyl)methanone.
| Compound Name | (4-hydroxy-1,2-oxazolidin-2-yl)-(2,4,5-trifluoro-3-hydroxyphenyl)methanone |
|---|---|
| PubChem CID | 112736689 |
| Molecular Formula | C10H8F3NO4 |
| Molecular Weight | 263.17 g/mol |
| Exact Mass | 263.04 |
| IUPAC Name | (4-hydroxy-1,2-oxazolidin-2-yl)-(2,4,5-trifluoro-3-hydroxyphenyl)methanone |
| SMILES | O=C(c1cc(F)c(F)c(O)c1F)N1CC(O)CO1 |
| InChI | InChI=1S/C10H8F3NO4/c11-6-1-5(7(12)9(16)8(6)13)10(17)14-2-4(15)3-18-14/h1,4,15-16H,2-3H2 |
| InChIKey | REPVMZHXGNSJEN-UHFFFAOYSA-N |
| XLogP | 0.56 |
| TPSA | 70.00 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 263.17 |
| LogP ≤ 5 | 0.56 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|