C15H24N2 — CID 112736704
(2R)-1-(3-methyl-3,4-dihydro-2H-quinolin-1-yl)pentan-2-amine (PubChem CID 112736704) has the molecular formula C15H24N2 and a molecular weight of 232.37 g/mol. Its IUPAC name is (2R)-1-(3-methyl-3,4-dihydro-2H-quinolin-1-yl)pentan-2-amine.
| Compound Name | (2R)-1-(3-methyl-3,4-dihydro-2H-quinolin-1-yl)pentan-2-amine |
|---|---|
| PubChem CID | 112736704 |
| Molecular Formula | C15H24N2 |
| Molecular Weight | 232.37 g/mol |
| Exact Mass | 232.19 |
| IUPAC Name | (2R)-1-(3-methyl-3,4-dihydro-2H-quinolin-1-yl)pentan-2-amine |
| SMILES | CCC[C@@H](N)CN1CC(C)Cc2ccccc21 |
| InChI | InChI=1S/C15H24N2/c1-3-6-14(16)11-17-10-12(2)9-13-7-4-5-8-15(13)17/h4-5,7-8,12,14H,3,6,9-11,16H2,1-2H3/t12?,14-/m1/s1 |
| InChIKey | MCIFJYMZXVEQHG-TYZXPVIJSA-N |
| XLogP | 2.81 |
| TPSA | 29.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 232.37 |
| LogP ≤ 5 | 2.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |