C18H14BrF3N4OS — CID 1127369
(5S,7S)-N-(4-bromophenyl)-5-thiophen-2-yl-7-(trifluoromethyl)-4,5,6,7-tetrahydropyrazolo[1,5-a]pyrimidine-3-carboxamide (PubChem CID 1127369) has the molecular formula C18H14BrF3N4OS and a molecular weight of 471.30 g/mol. Its IUPAC name is (5S,7S)-N-(4-bromophenyl)-5-thiophen-2-yl-7-(trifluoromethyl)-4,5,6,7-tetrahydropyrazolo[1,5-a]pyrimidine-3-carboxamide.
| Compound Name | (5S,7S)-N-(4-bromophenyl)-5-thiophen-2-yl-7-(trifluoromethyl)-4,5,6,7-tetrahydropyrazolo[1,5-a]pyrimidine-3-carboxamide |
|---|---|
| PubChem CID | 1127369 |
| Molecular Formula | C18H14BrF3N4OS |
| Molecular Weight | 471.30 g/mol |
| Exact Mass | 470.00 |
| IUPAC Name | (5S,7S)-N-(4-bromophenyl)-5-thiophen-2-yl-7-(trifluoromethyl)-4,5,6,7-tetrahydropyrazolo[1,5-a]pyrimidine-3-carboxamide |
| SMILES | O=C(Nc1ccc(Br)cc1)c1cnn2c1N[C@H](c1cccs1)C[C@H]2C(F)(F)F |
| InChI | InChI=1S/C18H14BrF3N4OS/c19-10-3-5-11(6-4-10)24-17(27)12-9-23-26-15(18(20,21)22)8-13(25-16(12)26)14-2-1-7-28-14/h1-7,9,13,15,25H,8H2,(H,24,27)/t13-,15-/m0/s1 |
| InChIKey | FSHMKVOCALCREH-ZFWWWQNUSA-N |
| XLogP | 5.62 |
| TPSA | 58.95 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 471.30 |
| LogP ≤ 5 | 5.62 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |