C36H48N6O5 — CID 11273722
[1-[[2-(4-phenylpiperazin-1-yl)pyrimidin-4-yl]oxymethyl]cyclobutyl]methyl N-[(3S)-2-hydroxy-1-oxo-1-[[(1R)-1-phenylethyl]amino]heptan-3-yl]carbamate (PubChem CID 11273722) has the molecular formula C36H48N6O5 and a molecular weight of 644.82 g/mol. Its IUPAC name is [1-[[2-(4-phenylpiperazin-1-yl)pyrimidin-4-yl]oxymethyl]cyclobutyl]methyl N-[(3S)-2-hydroxy-1-oxo-1-[[(1R)-1-phenylethyl]amino]heptan-3-yl]carbamate.
| Compound Name | [1-[[2-(4-phenylpiperazin-1-yl)pyrimidin-4-yl]oxymethyl]cyclobutyl]methyl N-[(3S)-2-hydroxy-1-oxo-1-[[(1R)-1-phenylethyl]amino]heptan-3-yl]carbamate |
|---|---|
| PubChem CID | 11273722 |
| Molecular Formula | C36H48N6O5 |
| Molecular Weight | 644.82 g/mol |
| Exact Mass | 644.37 |
| IUPAC Name | [1-[[2-(4-phenylpiperazin-1-yl)pyrimidin-4-yl]oxymethyl]cyclobutyl]methyl N-[(3S)-2-hydroxy-1-oxo-1-[[(1R)-1-phenylethyl]amino]heptan-3-yl]carbamate |
| SMILES | CCCC[C@H](NC(=O)OCC1(COc2ccnc(N3CCN(c4ccccc4)CC3)n2)CCC1)C(O)C(=O)N[C@H](C)c1ccccc1 |
| InChI | InChI=1S/C36H48N6O5/c1-3-4-16-30(32(43)33(44)38-27(2)28-12-7-5-8-13-28)39-35(45)47-26-36(18-11-19-36)25-46-31-17-20-37-34(40-31)42-23-21-41(22-24-42)29-14-9-6-10-15-29/h5-10,12-15,17,20,27,30,32,43H,3-4,11,16,18-19,21-26H2,1-2H3,(H,38,44)(H,39,45)/t27-,30+,32?/m1/s1 |
| InChIKey | WWHRBTSXQVQWSV-YDFYPMEXSA-N |
| XLogP | 4.88 |
| TPSA | 129.15 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 47 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 644.82 |
| LogP ≤ 5 | 4.88 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |