C13H18N2O3 — CID 112737306
N-(4-ethylphenyl)-2-[(4R)-4-hydroxy-1,2-oxazolidin-2-yl]acetamide (PubChem CID 112737306) has the molecular formula C13H18N2O3 and a molecular weight of 250.30 g/mol. Its IUPAC name is N-(4-ethylphenyl)-2-[(4R)-4-hydroxy-1,2-oxazolidin-2-yl]acetamide.
| Compound Name | N-(4-ethylphenyl)-2-[(4R)-4-hydroxy-1,2-oxazolidin-2-yl]acetamide |
|---|---|
| PubChem CID | 112737306 |
| Molecular Formula | C13H18N2O3 |
| Molecular Weight | 250.30 g/mol |
| Exact Mass | 250.13 |
| IUPAC Name | N-(4-ethylphenyl)-2-[(4R)-4-hydroxy-1,2-oxazolidin-2-yl]acetamide |
| SMILES | CCc1ccc(NC(=O)CN2C[C@@H](O)CO2)cc1 |
| InChI | InChI=1S/C13H18N2O3/c1-2-10-3-5-11(6-4-10)14-13(17)8-15-7-12(16)9-18-15/h3-6,12,16H,2,7-9H2,1H3,(H,14,17)/t12-/m1/s1 |
| InChIKey | MYZNZRBXLUFBBK-GFCCVEGCSA-N |
| XLogP | 0.80 |
| TPSA | 61.80 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 250.30 |
| LogP ≤ 5 | 0.80 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |