About (2R)-1-[2,2-dimethyl-3-(trifluoromethyl)pyrrolidin-1-yl]-4-methylsulfanylbutan-2-amine
(2R)-1-[2,2-dimethyl-3-(trifluoromethyl)pyrrolidin-1-yl]-4-methylsulfanylbutan-2-amine (PubChem CID 112737310) has the molecular formula C12H23F3N2S
and a molecular weight of 284.39 g/mol. Its IUPAC name is (2R)-1-[2,2-dimethyl-3-(trifluoromethyl)pyrrolidin-1-yl]-4-methylsulfanylbutan-2-amine.
Molecular Properties
| Compound Name | (2R)-1-[2,2-dimethyl-3-(trifluoromethyl)pyrrolidin-1-yl]-4-methylsulfanylbutan-2-amine |
| PubChem CID | 112737310 |
| Molecular Formula | C12H23F3N2S |
| Molecular Weight | 284.39 g/mol |
| Exact Mass | 284.15 |
| IUPAC Name | (2R)-1-[2,2-dimethyl-3-(trifluoromethyl)pyrrolidin-1-yl]-4-methylsulfanylbutan-2-amine |
| SMILES | CSCC[C@@H](N)CN1CCC(C(F)(F)F)C1(C)C |
| InChI | InChI=1S/C12H23F3N2S/c1-11(2)10(12(13,14)15)4-6-17(11)8-9(16)5-7-18-3/h9-10H,4-8,16H2,1-3H3/t9-,10?/m1/s1 |
| InChIKey | ZGMVQBSQYQDECW-YHMJZVADSA-N |
| XLogP | 2.73 |
| TPSA | 29.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 284.39 |
| LogP ≤ 5 | 2.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze (2R)-1-[2,2-dimethyl-3-(trifluoromethyl)pyrrolidin-1-yl]-4-methylsulfanylbutan-2-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2R)-1-[2,2-dimethyl-3-(trifluoromethyl)pyrrolidin-1-yl]-4-methylsulfanylbutan-2-amine?
The IUPAC name of (2R)-1-[2,2-dimethyl-3-(trifluoromethyl)pyrrolidin-1-yl]-4-methylsulfanylbutan-2-amine (CID 112737310) is (2R)-1-[2,2-dimethyl-3-(trifluoromethyl)pyrrolidin-1-yl]-4-methylsulfanylbutan-2-amine.
What is the SMILES notation for (2R)-1-[2,2-dimethyl-3-(trifluoromethyl)pyrrolidin-1-yl]-4-methylsulfanylbutan-2-amine?
The canonical SMILES for (2R)-1-[2,2-dimethyl-3-(trifluoromethyl)pyrrolidin-1-yl]-4-methylsulfanylbutan-2-amine is CSCC[C@@H](N)CN1CCC(C(F)(F)F)C1(C)C.
What is the InChIKey of (2R)-1-[2,2-dimethyl-3-(trifluoromethyl)pyrrolidin-1-yl]-4-methylsulfanylbutan-2-amine?
The InChIKey is ZGMVQBSQYQDECW-YHMJZVADSA-N. The full InChI is InChI=1S/C12H23F3N2S/c1-11(2)10(12(13,14)15)4-6-17(11)8-9(16)5-7-18-3/h9-10H,4-8,16H2,1-3H3/t9-,10?/m1/s1.
What are the key properties of (2R)-1-[2,2-dimethyl-3-(trifluoromethyl)pyrrolidin-1-yl]-4-methylsulfanylbutan-2-amine?
(2R)-1-[2,2-dimethyl-3-(trifluoromethyl)pyrrolidin-1-yl]-4-methylsulfanylbutan-2-amine has a molecular weight of 284.39 g/mol, XLogP of 2.73, 5 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (2R)-1-[2,2-dimethyl-3-(trifluoromethyl)pyrrolidin-1-yl]-4-methylsulfanylbutan-2-amine is sourced from PubChem (CID 112737310), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).