About 1-[(2-hydrazinyl-1,3-thiazol-5-yl)methyl]-4-(trifluoromethyl)azepan-4-ol
1-[(2-hydrazinyl-1,3-thiazol-5-yl)methyl]-4-(trifluoromethyl)azepan-4-ol (PubChem CID 112737795) has the molecular formula C11H17F3N4OS
and a molecular weight of 310.35 g/mol. Its IUPAC name is 1-[(2-hydrazinyl-1,3-thiazol-5-yl)methyl]-4-(trifluoromethyl)azepan-4-ol.
Molecular Properties
| Compound Name | 1-[(2-hydrazinyl-1,3-thiazol-5-yl)methyl]-4-(trifluoromethyl)azepan-4-ol |
| PubChem CID | 112737795 |
| Molecular Formula | C11H17F3N4OS |
| Molecular Weight | 310.35 g/mol |
| Exact Mass | 310.11 |
| IUPAC Name | 1-[(2-hydrazinyl-1,3-thiazol-5-yl)methyl]-4-(trifluoromethyl)azepan-4-ol |
| SMILES | NNc1ncc(CN2CCCC(O)(C(F)(F)F)CC2)s1 |
| InChI | InChI=1S/C11H17F3N4OS/c12-11(13,14)10(19)2-1-4-18(5-3-10)7-8-6-16-9(17-15)20-8/h6,19H,1-5,7,15H2,(H,16,17) |
| InChIKey | VJGVHORKPONENP-UHFFFAOYSA-N |
| XLogP | 1.71 |
| TPSA | 74.41 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 310.35 |
| LogP ≤ 5 | 1.71 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze 1-[(2-hydrazinyl-1,3-thiazol-5-yl)methyl]-4-(trifluoromethyl)azepan-4-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-[(2-hydrazinyl-1,3-thiazol-5-yl)methyl]-4-(trifluoromethyl)azepan-4-ol?
The IUPAC name of 1-[(2-hydrazinyl-1,3-thiazol-5-yl)methyl]-4-(trifluoromethyl)azepan-4-ol (CID 112737795) is 1-[(2-hydrazinyl-1,3-thiazol-5-yl)methyl]-4-(trifluoromethyl)azepan-4-ol.
What is the SMILES notation for 1-[(2-hydrazinyl-1,3-thiazol-5-yl)methyl]-4-(trifluoromethyl)azepan-4-ol?
The canonical SMILES for 1-[(2-hydrazinyl-1,3-thiazol-5-yl)methyl]-4-(trifluoromethyl)azepan-4-ol is NNc1ncc(CN2CCCC(O)(C(F)(F)F)CC2)s1.
What is the InChIKey of 1-[(2-hydrazinyl-1,3-thiazol-5-yl)methyl]-4-(trifluoromethyl)azepan-4-ol?
The InChIKey is VJGVHORKPONENP-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H17F3N4OS/c12-11(13,14)10(19)2-1-4-18(5-3-10)7-8-6-16-9(17-15)20-8/h6,19H,1-5,7,15H2,(H,16,17).
What are the key properties of 1-[(2-hydrazinyl-1,3-thiazol-5-yl)methyl]-4-(trifluoromethyl)azepan-4-ol?
1-[(2-hydrazinyl-1,3-thiazol-5-yl)methyl]-4-(trifluoromethyl)azepan-4-ol has a molecular weight of 310.35 g/mol, XLogP of 1.71, 3 rotatable bonds, 3 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 1-[(2-hydrazinyl-1,3-thiazol-5-yl)methyl]-4-(trifluoromethyl)azepan-4-ol is sourced from PubChem (CID 112737795), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).