About 1-[3-(ethylamino)-2,2-dimethylpropyl]-3-(trifluoromethyl)pyrrolidin-3-ol
1-[3-(ethylamino)-2,2-dimethylpropyl]-3-(trifluoromethyl)pyrrolidin-3-ol (PubChem CID 112737798) has the molecular formula C12H23F3N2O
and a molecular weight of 268.32 g/mol. Its IUPAC name is 1-[3-(ethylamino)-2,2-dimethylpropyl]-3-(trifluoromethyl)pyrrolidin-3-ol.
Molecular Properties
| Compound Name | 1-[3-(ethylamino)-2,2-dimethylpropyl]-3-(trifluoromethyl)pyrrolidin-3-ol |
| PubChem CID | 112737798 |
| Molecular Formula | C12H23F3N2O |
| Molecular Weight | 268.32 g/mol |
| Exact Mass | 268.18 |
| IUPAC Name | 1-[3-(ethylamino)-2,2-dimethylpropyl]-3-(trifluoromethyl)pyrrolidin-3-ol |
| SMILES | CCNCC(C)(C)CN1CCC(O)(C(F)(F)F)C1 |
| InChI | InChI=1S/C12H23F3N2O/c1-4-16-7-10(2,3)8-17-6-5-11(18,9-17)12(13,14)15/h16,18H,4-9H2,1-3H3 |
| InChIKey | DZNXRKINIVAPOE-UHFFFAOYSA-N |
| XLogP | 1.62 |
| TPSA | 35.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 268.32 |
| LogP ≤ 5 | 1.62 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 1-[3-(ethylamino)-2,2-dimethylpropyl]-3-(trifluoromethyl)pyrrolidin-3-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-[3-(ethylamino)-2,2-dimethylpropyl]-3-(trifluoromethyl)pyrrolidin-3-ol?
The IUPAC name of 1-[3-(ethylamino)-2,2-dimethylpropyl]-3-(trifluoromethyl)pyrrolidin-3-ol (CID 112737798) is 1-[3-(ethylamino)-2,2-dimethylpropyl]-3-(trifluoromethyl)pyrrolidin-3-ol.
What is the SMILES notation for 1-[3-(ethylamino)-2,2-dimethylpropyl]-3-(trifluoromethyl)pyrrolidin-3-ol?
The canonical SMILES for 1-[3-(ethylamino)-2,2-dimethylpropyl]-3-(trifluoromethyl)pyrrolidin-3-ol is CCNCC(C)(C)CN1CCC(O)(C(F)(F)F)C1.
What is the InChIKey of 1-[3-(ethylamino)-2,2-dimethylpropyl]-3-(trifluoromethyl)pyrrolidin-3-ol?
The InChIKey is DZNXRKINIVAPOE-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H23F3N2O/c1-4-16-7-10(2,3)8-17-6-5-11(18,9-17)12(13,14)15/h16,18H,4-9H2,1-3H3.
What are the key properties of 1-[3-(ethylamino)-2,2-dimethylpropyl]-3-(trifluoromethyl)pyrrolidin-3-ol?
1-[3-(ethylamino)-2,2-dimethylpropyl]-3-(trifluoromethyl)pyrrolidin-3-ol has a molecular weight of 268.32 g/mol, XLogP of 1.62, 5 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 1-[3-(ethylamino)-2,2-dimethylpropyl]-3-(trifluoromethyl)pyrrolidin-3-ol is sourced from PubChem (CID 112737798), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).