C11H18F3NO3 — CID 112737843
1-[4-hydroxy-4-(trifluoromethyl)azepan-1-yl]-2-methoxypropan-1-one (PubChem CID 112737843) has the molecular formula C11H18F3NO3 and a molecular weight of 269.26 g/mol. Its IUPAC name is 1-[4-hydroxy-4-(trifluoromethyl)azepan-1-yl]-2-methoxypropan-1-one.
| Compound Name | 1-[4-hydroxy-4-(trifluoromethyl)azepan-1-yl]-2-methoxypropan-1-one |
|---|---|
| PubChem CID | 112737843 |
| Molecular Formula | C11H18F3NO3 |
| Molecular Weight | 269.26 g/mol |
| Exact Mass | 269.12 |
| IUPAC Name | 1-[4-hydroxy-4-(trifluoromethyl)azepan-1-yl]-2-methoxypropan-1-one |
| SMILES | COC(C)C(=O)N1CCCC(O)(C(F)(F)F)CC1 |
| InChI | InChI=1S/C11H18F3NO3/c1-8(18-2)9(16)15-6-3-4-10(17,5-7-15)11(12,13)14/h8,17H,3-7H2,1-2H3 |
| InChIKey | OABOITXWBJVPDM-UHFFFAOYSA-N |
| XLogP | 1.33 |
| TPSA | 49.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 269.26 |
| LogP ≤ 5 | 1.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |