About 5-amino-N-(1,2-oxazol-4-yl)-3-(trifluoromethyl)pentanamide
5-amino-N-(1,2-oxazol-4-yl)-3-(trifluoromethyl)pentanamide (PubChem CID 112737872) has the molecular formula C9H12F3N3O2
and a molecular weight of 251.21 g/mol. Its IUPAC name is 5-amino-N-(1,2-oxazol-4-yl)-3-(trifluoromethyl)pentanamide.
Molecular Properties
| Compound Name | 5-amino-N-(1,2-oxazol-4-yl)-3-(trifluoromethyl)pentanamide |
| PubChem CID | 112737872 |
| Molecular Formula | C9H12F3N3O2 |
| Molecular Weight | 251.21 g/mol |
| Exact Mass | 251.09 |
| IUPAC Name | 5-amino-N-(1,2-oxazol-4-yl)-3-(trifluoromethyl)pentanamide |
| SMILES | NCCC(CC(=O)Nc1cnoc1)C(F)(F)F |
| InChI | InChI=1S/C9H12F3N3O2/c10-9(11,12)6(1-2-13)3-8(16)15-7-4-14-17-5-7/h4-6H,1-3,13H2,(H,15,16) |
| InChIKey | FHSJUEVVWBSTHL-UHFFFAOYSA-N |
| XLogP | 1.53 |
| TPSA | 81.15 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 251.21 |
| LogP ≤ 5 | 1.53 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 5-amino-N-(1,2-oxazol-4-yl)-3-(trifluoromethyl)pentanamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-amino-N-(1,2-oxazol-4-yl)-3-(trifluoromethyl)pentanamide?
The IUPAC name of 5-amino-N-(1,2-oxazol-4-yl)-3-(trifluoromethyl)pentanamide (CID 112737872) is 5-amino-N-(1,2-oxazol-4-yl)-3-(trifluoromethyl)pentanamide.
What is the SMILES notation for 5-amino-N-(1,2-oxazol-4-yl)-3-(trifluoromethyl)pentanamide?
The canonical SMILES for 5-amino-N-(1,2-oxazol-4-yl)-3-(trifluoromethyl)pentanamide is NCCC(CC(=O)Nc1cnoc1)C(F)(F)F.
What is the InChIKey of 5-amino-N-(1,2-oxazol-4-yl)-3-(trifluoromethyl)pentanamide?
The InChIKey is FHSJUEVVWBSTHL-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H12F3N3O2/c10-9(11,12)6(1-2-13)3-8(16)15-7-4-14-17-5-7/h4-6H,1-3,13H2,(H,15,16).
What are the key properties of 5-amino-N-(1,2-oxazol-4-yl)-3-(trifluoromethyl)pentanamide?
5-amino-N-(1,2-oxazol-4-yl)-3-(trifluoromethyl)pentanamide has a molecular weight of 251.21 g/mol, XLogP of 1.53, 5 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 5-amino-N-(1,2-oxazol-4-yl)-3-(trifluoromethyl)pentanamide is sourced from PubChem (CID 112737872), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).