About N'-methyl-N'-(thiolan-3-yl)-3-(trifluoromethyl)pentane-1,5-diamine
N'-methyl-N'-(thiolan-3-yl)-3-(trifluoromethyl)pentane-1,5-diamine (PubChem CID 112737916) has the molecular formula C11H21F3N2S
and a molecular weight of 270.36 g/mol. Its IUPAC name is N'-methyl-N'-(thiolan-3-yl)-3-(trifluoromethyl)pentane-1,5-diamine.
Molecular Properties
| Compound Name | N'-methyl-N'-(thiolan-3-yl)-3-(trifluoromethyl)pentane-1,5-diamine |
| PubChem CID | 112737916 |
| Molecular Formula | C11H21F3N2S |
| Molecular Weight | 270.36 g/mol |
| Exact Mass | 270.14 |
| IUPAC Name | N'-methyl-N'-(thiolan-3-yl)-3-(trifluoromethyl)pentane-1,5-diamine |
| SMILES | CN(CCC(CCN)C(F)(F)F)C1CCSC1 |
| InChI | InChI=1S/C11H21F3N2S/c1-16(10-4-7-17-8-10)6-3-9(2-5-15)11(12,13)14/h9-10H,2-8,15H2,1H3 |
| InChIKey | APIHSKHDESOIFQ-UHFFFAOYSA-N |
| XLogP | 2.34 |
| TPSA | 29.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 270.36 |
| LogP ≤ 5 | 2.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze N'-methyl-N'-(thiolan-3-yl)-3-(trifluoromethyl)pentane-1,5-diamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N'-methyl-N'-(thiolan-3-yl)-3-(trifluoromethyl)pentane-1,5-diamine?
The IUPAC name of N'-methyl-N'-(thiolan-3-yl)-3-(trifluoromethyl)pentane-1,5-diamine (CID 112737916) is N'-methyl-N'-(thiolan-3-yl)-3-(trifluoromethyl)pentane-1,5-diamine.
What is the SMILES notation for N'-methyl-N'-(thiolan-3-yl)-3-(trifluoromethyl)pentane-1,5-diamine?
The canonical SMILES for N'-methyl-N'-(thiolan-3-yl)-3-(trifluoromethyl)pentane-1,5-diamine is CN(CCC(CCN)C(F)(F)F)C1CCSC1.
What is the InChIKey of N'-methyl-N'-(thiolan-3-yl)-3-(trifluoromethyl)pentane-1,5-diamine?
The InChIKey is APIHSKHDESOIFQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H21F3N2S/c1-16(10-4-7-17-8-10)6-3-9(2-5-15)11(12,13)14/h9-10H,2-8,15H2,1H3.
What are the key properties of N'-methyl-N'-(thiolan-3-yl)-3-(trifluoromethyl)pentane-1,5-diamine?
N'-methyl-N'-(thiolan-3-yl)-3-(trifluoromethyl)pentane-1,5-diamine has a molecular weight of 270.36 g/mol, XLogP of 2.34, 6 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for N'-methyl-N'-(thiolan-3-yl)-3-(trifluoromethyl)pentane-1,5-diamine is sourced from PubChem (CID 112737916), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).