About N'-(1,3-thiazol-5-ylmethyl)-3-(trifluoromethyl)pentane-1,5-diamine
N'-(1,3-thiazol-5-ylmethyl)-3-(trifluoromethyl)pentane-1,5-diamine (PubChem CID 112737936) has the molecular formula C10H16F3N3S
and a molecular weight of 267.32 g/mol. Its IUPAC name is N'-(1,3-thiazol-5-ylmethyl)-3-(trifluoromethyl)pentane-1,5-diamine.
Molecular Properties
| Compound Name | N'-(1,3-thiazol-5-ylmethyl)-3-(trifluoromethyl)pentane-1,5-diamine |
| PubChem CID | 112737936 |
| Molecular Formula | C10H16F3N3S |
| Molecular Weight | 267.32 g/mol |
| Exact Mass | 267.10 |
| IUPAC Name | N'-(1,3-thiazol-5-ylmethyl)-3-(trifluoromethyl)pentane-1,5-diamine |
| SMILES | NCCC(CCNCc1cncs1)C(F)(F)F |
| InChI | InChI=1S/C10H16F3N3S/c11-10(12,13)8(1-3-14)2-4-15-5-9-6-16-7-17-9/h6-8,15H,1-5,14H2 |
| InChIKey | HBKPHNLWJXNEQV-UHFFFAOYSA-N |
| XLogP | 2.15 |
| TPSA | 50.94 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 267.32 |
| LogP ≤ 5 | 2.15 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze N'-(1,3-thiazol-5-ylmethyl)-3-(trifluoromethyl)pentane-1,5-diamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N'-(1,3-thiazol-5-ylmethyl)-3-(trifluoromethyl)pentane-1,5-diamine?
The IUPAC name of N'-(1,3-thiazol-5-ylmethyl)-3-(trifluoromethyl)pentane-1,5-diamine (CID 112737936) is N'-(1,3-thiazol-5-ylmethyl)-3-(trifluoromethyl)pentane-1,5-diamine.
What is the SMILES notation for N'-(1,3-thiazol-5-ylmethyl)-3-(trifluoromethyl)pentane-1,5-diamine?
The canonical SMILES for N'-(1,3-thiazol-5-ylmethyl)-3-(trifluoromethyl)pentane-1,5-diamine is NCCC(CCNCc1cncs1)C(F)(F)F.
What is the InChIKey of N'-(1,3-thiazol-5-ylmethyl)-3-(trifluoromethyl)pentane-1,5-diamine?
The InChIKey is HBKPHNLWJXNEQV-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H16F3N3S/c11-10(12,13)8(1-3-14)2-4-15-5-9-6-16-7-17-9/h6-8,15H,1-5,14H2.
What are the key properties of N'-(1,3-thiazol-5-ylmethyl)-3-(trifluoromethyl)pentane-1,5-diamine?
N'-(1,3-thiazol-5-ylmethyl)-3-(trifluoromethyl)pentane-1,5-diamine has a molecular weight of 267.32 g/mol, XLogP of 2.15, 7 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for N'-(1,3-thiazol-5-ylmethyl)-3-(trifluoromethyl)pentane-1,5-diamine is sourced from PubChem (CID 112737936), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).