C11H17N3O3 — CID 112738961
3-(2-aminoethoxy)-N-(6-methoxy-3-pyridinyl)propanamide (PubChem CID 112738961) has the molecular formula C11H17N3O3 and a molecular weight of 239.28 g/mol. Its IUPAC name is 3-(2-aminoethoxy)-N-(6-methoxy-3-pyridinyl)propanamide.
| Compound Name | 3-(2-aminoethoxy)-N-(6-methoxy-3-pyridinyl)propanamide |
|---|---|
| PubChem CID | 112738961 |
| Molecular Formula | C11H17N3O3 |
| Molecular Weight | 239.28 g/mol |
| Exact Mass | 239.13 |
| IUPAC Name | 3-(2-aminoethoxy)-N-(6-methoxy-3-pyridinyl)propanamide |
| SMILES | COc1ccc(NC(=O)CCOCCN)cn1 |
| InChI | InChI=1S/C11H17N3O3/c1-16-11-3-2-9(8-13-11)14-10(15)4-6-17-7-5-12/h2-3,8H,4-7,12H2,1H3,(H,14,15) |
| InChIKey | OFDSAPVXGWVJIQ-UHFFFAOYSA-N |
| XLogP | 0.39 |
| TPSA | 86.47 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 239.28 |
| LogP ≤ 5 | 0.39 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|