C44H39N2O6 — CID 11273979
CID 11273979 (PubChem CID 11273979) has the molecular formula C44H39N2O6 and a molecular weight of 691.80 g/mol.
| Compound Name | CID 11273979 |
|---|---|
| PubChem CID | 11273979 |
| Molecular Formula | C44H39N2O6 |
| Molecular Weight | 691.80 g/mol |
| Exact Mass | 691.28 |
| IUPAC Name | — |
| SMILES | CC1(C)[C@@H](NC(=O)OCC2c3ccccc3-c3ccccc32)[C@H](C(=O)Oc2ccc3ccccc3c2-c2c(O)ccc3ccccc23)C(C)(C)N1[O] |
| InChI | InChI=1S/C44H39N2O6/c1-43(2)39(40(44(3,4)46(43)50)45-42(49)51-25-34-32-19-11-9-17-30(32)31-18-10-12-20-33(31)34)41(48)52-36-24-22-27-14-6-8-16-29(27)38(36)37-28-15-7-5-13-26(28)21-23-35(37)47/h5-24,34,39-40,47H,25H2,1-4H3,(H,45,49)/t39-,40+/m1/s1 |
| InChIKey | OJFBJSXETINOFZ-PVXQIPPMSA-N |
| XLogP | 9.01 |
| TPSA | 108.00 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 52 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 691.80 |
| LogP ≤ 5 | 9.01 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|