C14H23ClN2 — CID 112740921
4-chloro-3-methyl-2-N-(2,2,3-trimethylbutyl)benzene-1,2-diamine (PubChem CID 112740921) has the molecular formula C14H23ClN2 and a molecular weight of 254.80 g/mol. Its IUPAC name is 4-chloro-3-methyl-2-N-(2,2,3-trimethylbutyl)benzene-1,2-diamine.
| Compound Name | 4-chloro-3-methyl-2-N-(2,2,3-trimethylbutyl)benzene-1,2-diamine |
|---|---|
| PubChem CID | 112740921 |
| Molecular Formula | C14H23ClN2 |
| Molecular Weight | 254.80 g/mol |
| Exact Mass | 254.15 |
| IUPAC Name | 4-chloro-3-methyl-2-N-(2,2,3-trimethylbutyl)benzene-1,2-diamine |
| SMILES | Cc1c(Cl)ccc(N)c1NCC(C)(C)C(C)C |
| InChI | InChI=1S/C14H23ClN2/c1-9(2)14(4,5)8-17-13-10(3)11(15)6-7-12(13)16/h6-7,9,17H,8,16H2,1-5H3 |
| InChIKey | YVCYUKIIBCYWSX-UHFFFAOYSA-N |
| XLogP | 4.32 |
| TPSA | 38.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 254.80 |
| LogP ≤ 5 | 4.32 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|