C10H12F4N2O2 — CID 112741272
2-[3,5-dimethyl-1-(2,2,3,3-tetrafluoropropyl)pyrazol-4-yl]acetic acid (PubChem CID 112741272) has the molecular formula C10H12F4N2O2 and a molecular weight of 268.21 g/mol. Its IUPAC name is 2-[3,5-dimethyl-1-(2,2,3,3-tetrafluoropropyl)pyrazol-4-yl]acetic acid.
| Compound Name | 2-[3,5-dimethyl-1-(2,2,3,3-tetrafluoropropyl)pyrazol-4-yl]acetic acid |
|---|---|
| PubChem CID | 112741272 |
| Molecular Formula | C10H12F4N2O2 |
| Molecular Weight | 268.21 g/mol |
| Exact Mass | 268.08 |
| IUPAC Name | 2-[3,5-dimethyl-1-(2,2,3,3-tetrafluoropropyl)pyrazol-4-yl]acetic acid |
| SMILES | Cc1nn(CC(F)(F)C(F)F)c(C)c1CC(=O)O |
| InChI | InChI=1S/C10H12F4N2O2/c1-5-7(3-8(17)18)6(2)16(15-5)4-10(13,14)9(11)12/h9H,3-4H2,1-2H3,(H,17,18) |
| InChIKey | FLXIGKKVNXHRIS-UHFFFAOYSA-N |
| XLogP | 2.03 |
| TPSA | 55.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 268.21 |
| LogP ≤ 5 | 2.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|