C20H27BN2O4 — CID 112741618
2-[[4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]methyl]-6,7,8,8a-tetrahydro-3H-pyrrolo[1,2-a]pyrazine-1,4-dione (PubChem CID 112741618) has the molecular formula C20H27BN2O4 and a molecular weight of 370.26 g/mol. Its IUPAC name is 2-[[4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]methyl]-6,7,8,8a-tetrahydro-3H-pyrrolo[1,2-a]pyrazine-1,4-dione.
| Compound Name | 2-[[4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]methyl]-6,7,8,8a-tetrahydro-3H-pyrrolo[1,2-a]pyrazine-1,4-dione |
|---|---|
| PubChem CID | 112741618 |
| Molecular Formula | C20H27BN2O4 |
| Molecular Weight | 370.26 g/mol |
| Exact Mass | 370.21 |
| IUPAC Name | 2-[[4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]methyl]-6,7,8,8a-tetrahydro-3H-pyrrolo[1,2-a]pyrazine-1,4-dione |
| SMILES | CC1(C)OB(c2ccc(CN3CC(=O)N4CCCC4C3=O)cc2)OC1(C)C |
| InChI | InChI=1S/C20H27BN2O4/c1-19(2)20(3,4)27-21(26-19)15-9-7-14(8-10-15)12-22-13-17(24)23-11-5-6-16(23)18(22)25/h7-10,16H,5-6,11-13H2,1-4H3 |
| InChIKey | MAVIEDTYXZZHKU-UHFFFAOYSA-N |
| XLogP | 1.32 |
| TPSA | 59.08 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.26 |
| LogP ≤ 5 | 1.32 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|