C43H52IO4P — CID 11274338
2-[(4R,6R)-6-[(1E,3E,8R)-8-[(4-methoxyphenyl)methoxy]nona-1,3-dienyl]-2,2-dimethyl-1,3-dioxan-4-yl]ethyl-triphenylphosphanium iodide (PubChem CID 11274338) has the molecular formula C43H52IO4P and a molecular weight of 790.76 g/mol. Its IUPAC name is 2-[(4R,6R)-6-[(1E,3E,8R)-8-[(4-methoxyphenyl)methoxy]nona-1,3-dienyl]-2,2-dimethyl-1,3-dioxan-4-yl]ethyl-triphenylphosphanium iodide.
| Compound Name | 2-[(4R,6R)-6-[(1E,3E,8R)-8-[(4-methoxyphenyl)methoxy]nona-1,3-dienyl]-2,2-dimethyl-1,3-dioxan-4-yl]ethyl-triphenylphosphanium iodide |
|---|---|
| PubChem CID | 11274338 |
| Molecular Formula | C43H52IO4P |
| Molecular Weight | 790.76 g/mol |
| Exact Mass | 790.26 |
| IUPAC Name | 2-[(4R,6R)-6-[(1E,3E,8R)-8-[(4-methoxyphenyl)methoxy]nona-1,3-dienyl]-2,2-dimethyl-1,3-dioxan-4-yl]ethyl-triphenylphosphanium iodide |
| SMILES | COc1ccc(CO[C@H](C)CCC/C=C/C=C/[C@H]2C[C@H](CC[P+](c3ccccc3)(c3ccccc3)c3ccccc3)OC(C)(C)O2)cc1.[I-] |
| InChI | InChI=1S/C43H52O4P.HI/c1-35(45-34-36-27-29-37(44-4)30-28-36)19-11-6-5-7-12-20-38-33-39(47-43(2,3)46-38)31-32-48(40-21-13-8-14-22-40,41-23-15-9-16-24-41)42-25-17-10-18-26-42;/h5,7-10,12-18,20-30,35,38-39H,6,11,19,31-34H2,1-4H3;1H/q+1;/p-1/b7-5+,20-12+;/t35-,38+,39+;/m1./s1 |
| InChIKey | MARGHCACEJZFFI-WOVNEYCHSA-M |
| XLogP | 6.18 |
| TPSA | 36.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 49 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 790.76 |
| LogP ≤ 5 | 6.18 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|