About 6-bromo-2,2-di(propan-2-yl)-3,4-dihydrochromen-4-ol
6-bromo-2,2-di(propan-2-yl)-3,4-dihydrochromen-4-ol (PubChem CID 112743534) has the molecular formula C15H21BrO2
and a molecular weight of 313.24 g/mol. Its IUPAC name is 6-bromo-2,2-di(propan-2-yl)-3,4-dihydrochromen-4-ol.
Molecular Properties
| Compound Name | 6-bromo-2,2-di(propan-2-yl)-3,4-dihydrochromen-4-ol |
| PubChem CID | 112743534 |
| Molecular Formula | C15H21BrO2 |
| Molecular Weight | 313.24 g/mol |
| Exact Mass | 312.07 |
| IUPAC Name | 6-bromo-2,2-di(propan-2-yl)-3,4-dihydrochromen-4-ol |
| SMILES | CC(C)C1(C(C)C)CC(O)c2cc(Br)ccc2O1 |
| InChI | InChI=1S/C15H21BrO2/c1-9(2)15(10(3)4)8-13(17)12-7-11(16)5-6-14(12)18-15/h5-7,9-10,13,17H,8H2,1-4H3 |
| InChIKey | LUQLVVZRQBETOY-UHFFFAOYSA-N |
| XLogP | 4.32 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 313.24 |
| LogP ≤ 5 | 4.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 6-bromo-2,2-di(propan-2-yl)-3,4-dihydrochromen-4-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-bromo-2,2-di(propan-2-yl)-3,4-dihydrochromen-4-ol?
The IUPAC name of 6-bromo-2,2-di(propan-2-yl)-3,4-dihydrochromen-4-ol (CID 112743534) is 6-bromo-2,2-di(propan-2-yl)-3,4-dihydrochromen-4-ol.
What is the SMILES notation for 6-bromo-2,2-di(propan-2-yl)-3,4-dihydrochromen-4-ol?
The canonical SMILES for 6-bromo-2,2-di(propan-2-yl)-3,4-dihydrochromen-4-ol is CC(C)C1(C(C)C)CC(O)c2cc(Br)ccc2O1.
What is the InChIKey of 6-bromo-2,2-di(propan-2-yl)-3,4-dihydrochromen-4-ol?
The InChIKey is LUQLVVZRQBETOY-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H21BrO2/c1-9(2)15(10(3)4)8-13(17)12-7-11(16)5-6-14(12)18-15/h5-7,9-10,13,17H,8H2,1-4H3.
What are the key properties of 6-bromo-2,2-di(propan-2-yl)-3,4-dihydrochromen-4-ol?
6-bromo-2,2-di(propan-2-yl)-3,4-dihydrochromen-4-ol has a molecular weight of 313.24 g/mol, XLogP of 4.32, 2 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 6-bromo-2,2-di(propan-2-yl)-3,4-dihydrochromen-4-ol is sourced from PubChem (CID 112743534), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).