C16H28O — CID 112743634
2,2-dicyclopropyl-1-(4-ethylcyclohexyl)ethanol (PubChem CID 112743634) has the molecular formula C16H28O and a molecular weight of 236.40 g/mol. Its IUPAC name is 2,2-dicyclopropyl-1-(4-ethylcyclohexyl)ethanol.
| Compound Name | 2,2-dicyclopropyl-1-(4-ethylcyclohexyl)ethanol |
|---|---|
| PubChem CID | 112743634 |
| Molecular Formula | C16H28O |
| Molecular Weight | 236.40 g/mol |
| Exact Mass | 236.21 |
| IUPAC Name | 2,2-dicyclopropyl-1-(4-ethylcyclohexyl)ethanol |
| SMILES | CCC1CCC(C(O)C(C2CC2)C2CC2)CC1 |
| InChI | InChI=1S/C16H28O/c1-2-11-3-5-14(6-4-11)16(17)15(12-7-8-12)13-9-10-13/h11-17H,2-10H2,1H3 |
| InChIKey | BPVBPJUWSHZVJT-UHFFFAOYSA-N |
| XLogP | 4.00 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 236.40 |
| LogP ≤ 5 | 4.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |