About [1,1-dicyclopropyl-3-(3,3-difluorocyclohexyl)propan-2-yl]hydrazine
[1,1-dicyclopropyl-3-(3,3-difluorocyclohexyl)propan-2-yl]hydrazine (PubChem CID 112743839) has the molecular formula C15H26F2N2
and a molecular weight of 272.38 g/mol. Its IUPAC name is [1,1-dicyclopropyl-3-(3,3-difluorocyclohexyl)propan-2-yl]hydrazine.
Molecular Properties
| Compound Name | [1,1-dicyclopropyl-3-(3,3-difluorocyclohexyl)propan-2-yl]hydrazine |
| PubChem CID | 112743839 |
| Molecular Formula | C15H26F2N2 |
| Molecular Weight | 272.38 g/mol |
| Exact Mass | 272.21 |
| IUPAC Name | [1,1-dicyclopropyl-3-(3,3-difluorocyclohexyl)propan-2-yl]hydrazine |
| SMILES | NNC(CC1CCCC(F)(F)C1)C(C1CC1)C1CC1 |
| InChI | InChI=1S/C15H26F2N2/c16-15(17)7-1-2-10(9-15)8-13(19-18)14(11-3-4-11)12-5-6-12/h10-14,19H,1-9,18H2 |
| InChIKey | MKAJNCVAUJPBFV-UHFFFAOYSA-N |
| XLogP | 3.47 |
| TPSA | 38.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 272.38 |
| LogP ≤ 5 | 3.47 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze [1,1-dicyclopropyl-3-(3,3-difluorocyclohexyl)propan-2-yl]hydrazine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [1,1-dicyclopropyl-3-(3,3-difluorocyclohexyl)propan-2-yl]hydrazine?
The IUPAC name of [1,1-dicyclopropyl-3-(3,3-difluorocyclohexyl)propan-2-yl]hydrazine (CID 112743839) is [1,1-dicyclopropyl-3-(3,3-difluorocyclohexyl)propan-2-yl]hydrazine.
What is the SMILES notation for [1,1-dicyclopropyl-3-(3,3-difluorocyclohexyl)propan-2-yl]hydrazine?
The canonical SMILES for [1,1-dicyclopropyl-3-(3,3-difluorocyclohexyl)propan-2-yl]hydrazine is NNC(CC1CCCC(F)(F)C1)C(C1CC1)C1CC1.
What is the InChIKey of [1,1-dicyclopropyl-3-(3,3-difluorocyclohexyl)propan-2-yl]hydrazine?
The InChIKey is MKAJNCVAUJPBFV-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H26F2N2/c16-15(17)7-1-2-10(9-15)8-13(19-18)14(11-3-4-11)12-5-6-12/h10-14,19H,1-9,18H2.
What are the key properties of [1,1-dicyclopropyl-3-(3,3-difluorocyclohexyl)propan-2-yl]hydrazine?
[1,1-dicyclopropyl-3-(3,3-difluorocyclohexyl)propan-2-yl]hydrazine has a molecular weight of 272.38 g/mol, XLogP of 3.47, 6 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for [1,1-dicyclopropyl-3-(3,3-difluorocyclohexyl)propan-2-yl]hydrazine is sourced from PubChem (CID 112743839), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).