C12H13BrIN3O — CID 112744828
(2-bromo-5-iodophenyl)-(2-propyl-1,2,4-triazol-3-yl)methanol (PubChem CID 112744828) has the molecular formula C12H13BrIN3O and a molecular weight of 422.06 g/mol. Its IUPAC name is (2-bromo-5-iodophenyl)-(2-propyl-1,2,4-triazol-3-yl)methanol.
| Compound Name | (2-bromo-5-iodophenyl)-(2-propyl-1,2,4-triazol-3-yl)methanol |
|---|---|
| PubChem CID | 112744828 |
| Molecular Formula | C12H13BrIN3O |
| Molecular Weight | 422.06 g/mol |
| Exact Mass | 420.93 |
| IUPAC Name | (2-bromo-5-iodophenyl)-(2-propyl-1,2,4-triazol-3-yl)methanol |
| SMILES | CCCn1ncnc1C(O)c1cc(I)ccc1Br |
| InChI | InChI=1S/C12H13BrIN3O/c1-2-5-17-12(15-7-16-17)11(18)9-6-8(14)3-4-10(9)13/h3-4,6-7,11,18H,2,5H2,1H3 |
| InChIKey | NNFFEDNZMQPJIY-UHFFFAOYSA-N |
| XLogP | 3.14 |
| TPSA | 50.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 422.06 |
| LogP ≤ 5 | 3.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|