C15H21NO — CID 112745195
1,1-dicyclopropyl-3-(5-methyl-2-pyridinyl)propan-2-ol (PubChem CID 112745195) has the molecular formula C15H21NO and a molecular weight of 231.34 g/mol. Its IUPAC name is 1,1-dicyclopropyl-3-(5-methyl-2-pyridinyl)propan-2-ol.
| Compound Name | 1,1-dicyclopropyl-3-(5-methyl-2-pyridinyl)propan-2-ol |
|---|---|
| PubChem CID | 112745195 |
| Molecular Formula | C15H21NO |
| Molecular Weight | 231.34 g/mol |
| Exact Mass | 231.16 |
| IUPAC Name | 1,1-dicyclopropyl-3-(5-methyl-2-pyridinyl)propan-2-ol |
| SMILES | Cc1ccc(CC(O)C(C2CC2)C2CC2)nc1 |
| InChI | InChI=1S/C15H21NO/c1-10-2-7-13(16-9-10)8-14(17)15(11-3-4-11)12-5-6-12/h2,7,9,11-12,14-15,17H,3-6,8H2,1H3 |
| InChIKey | SWDAXLCNYLSFIM-UHFFFAOYSA-N |
| XLogP | 2.73 |
| TPSA | 33.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 231.34 |
| LogP ≤ 5 | 2.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |