C13H14F3N3S — CID 112745747
[3-pyridin-3-yl-1-[4-(trifluoromethyl)thiophen-3-yl]propyl]hydrazine (PubChem CID 112745747) has the molecular formula C13H14F3N3S and a molecular weight of 301.34 g/mol. Its IUPAC name is [3-pyridin-3-yl-1-[4-(trifluoromethyl)thiophen-3-yl]propyl]hydrazine.
| Compound Name | [3-pyridin-3-yl-1-[4-(trifluoromethyl)thiophen-3-yl]propyl]hydrazine |
|---|---|
| PubChem CID | 112745747 |
| Molecular Formula | C13H14F3N3S |
| Molecular Weight | 301.34 g/mol |
| Exact Mass | 301.09 |
| IUPAC Name | [3-pyridin-3-yl-1-[4-(trifluoromethyl)thiophen-3-yl]propyl]hydrazine |
| SMILES | NNC(CCc1cccnc1)c1cscc1C(F)(F)F |
| InChI | InChI=1S/C13H14F3N3S/c14-13(15,16)11-8-20-7-10(11)12(19-17)4-3-9-2-1-5-18-6-9/h1-2,5-8,12,19H,3-4,17H2 |
| InChIKey | JOQAGNKPMSWYLR-UHFFFAOYSA-N |
| XLogP | 3.30 |
| TPSA | 50.94 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 301.34 |
| LogP ≤ 5 | 3.30 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|