C13H23N5 — CID 112746281
6-ethyl-2-N-[(2,2,3,3-tetramethylcyclopropyl)methyl]-1,3,5-triazine-2,4-diamine (PubChem CID 112746281) has the molecular formula C13H23N5 and a molecular weight of 249.36 g/mol. Its IUPAC name is 6-ethyl-2-N-[(2,2,3,3-tetramethylcyclopropyl)methyl]-1,3,5-triazine-2,4-diamine.
| Compound Name | 6-ethyl-2-N-[(2,2,3,3-tetramethylcyclopropyl)methyl]-1,3,5-triazine-2,4-diamine |
|---|---|
| PubChem CID | 112746281 |
| Molecular Formula | C13H23N5 |
| Molecular Weight | 249.36 g/mol |
| Exact Mass | 249.20 |
| IUPAC Name | 6-ethyl-2-N-[(2,2,3,3-tetramethylcyclopropyl)methyl]-1,3,5-triazine-2,4-diamine |
| SMILES | CCc1nc(N)nc(NCC2C(C)(C)C2(C)C)n1 |
| InChI | InChI=1S/C13H23N5/c1-6-9-16-10(14)18-11(17-9)15-7-8-12(2,3)13(8,4)5/h8H,6-7H2,1-5H3,(H3,14,15,16,17,18) |
| InChIKey | DDEVSGYQYSNYGZ-UHFFFAOYSA-N |
| XLogP | 2.11 |
| TPSA | 76.72 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 249.36 |
| LogP ≤ 5 | 2.11 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |