C9H12F3N5S — CID 112746461
6-cyclopropyl-2-N-[2-(trifluoromethylsulfanyl)ethyl]-1,3,5-triazine-2,4-diamine (PubChem CID 112746461) has the molecular formula C9H12F3N5S and a molecular weight of 279.29 g/mol. Its IUPAC name is 6-cyclopropyl-2-N-[2-(trifluoromethylsulfanyl)ethyl]-1,3,5-triazine-2,4-diamine.
| Compound Name | 6-cyclopropyl-2-N-[2-(trifluoromethylsulfanyl)ethyl]-1,3,5-triazine-2,4-diamine |
|---|---|
| PubChem CID | 112746461 |
| Molecular Formula | C9H12F3N5S |
| Molecular Weight | 279.29 g/mol |
| Exact Mass | 279.08 |
| IUPAC Name | 6-cyclopropyl-2-N-[2-(trifluoromethylsulfanyl)ethyl]-1,3,5-triazine-2,4-diamine |
| SMILES | Nc1nc(NCCSC(F)(F)F)nc(C2CC2)n1 |
| InChI | InChI=1S/C9H12F3N5S/c10-9(11,12)18-4-3-14-8-16-6(5-1-2-5)15-7(13)17-8/h5H,1-4H2,(H3,13,14,15,16,17) |
| InChIKey | KJTRRCIKKCPDMH-UHFFFAOYSA-N |
| XLogP | 2.00 |
| TPSA | 76.72 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 279.29 |
| LogP ≤ 5 | 2.00 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|