C15H19Br2NO — CID 112747391
1-(4-bromo-3,3-dimethylpiperidin-1-yl)-2-(4-bromophenyl)ethanone (PubChem CID 112747391) has the molecular formula C15H19Br2NO and a molecular weight of 389.13 g/mol. Its IUPAC name is 1-(4-bromo-3,3-dimethylpiperidin-1-yl)-2-(4-bromophenyl)ethanone.
| Compound Name | 1-(4-bromo-3,3-dimethylpiperidin-1-yl)-2-(4-bromophenyl)ethanone |
|---|---|
| PubChem CID | 112747391 |
| Molecular Formula | C15H19Br2NO |
| Molecular Weight | 389.13 g/mol |
| Exact Mass | 386.98 |
| IUPAC Name | 1-(4-bromo-3,3-dimethylpiperidin-1-yl)-2-(4-bromophenyl)ethanone |
| SMILES | CC1(C)CN(C(=O)Cc2ccc(Br)cc2)CCC1Br |
| InChI | InChI=1S/C15H19Br2NO/c1-15(2)10-18(8-7-13(15)17)14(19)9-11-3-5-12(16)6-4-11/h3-6,13H,7-10H2,1-2H3 |
| InChIKey | UEAOXGMWPRKFPM-UHFFFAOYSA-N |
| XLogP | 4.01 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 389.13 |
| LogP ≤ 5 | 4.01 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|