C15H26BrNO2 — CID 112747394
(4-bromo-3,3-dimethylpiperidin-1-yl)-(2,4,5-trimethyloxolan-3-yl)methanone (PubChem CID 112747394) has the molecular formula C15H26BrNO2 and a molecular weight of 332.28 g/mol. Its IUPAC name is (4-bromo-3,3-dimethylpiperidin-1-yl)-(2,4,5-trimethyloxolan-3-yl)methanone.
| Compound Name | (4-bromo-3,3-dimethylpiperidin-1-yl)-(2,4,5-trimethyloxolan-3-yl)methanone |
|---|---|
| PubChem CID | 112747394 |
| Molecular Formula | C15H26BrNO2 |
| Molecular Weight | 332.28 g/mol |
| Exact Mass | 331.11 |
| IUPAC Name | (4-bromo-3,3-dimethylpiperidin-1-yl)-(2,4,5-trimethyloxolan-3-yl)methanone |
| SMILES | CC1OC(C)C(C(=O)N2CCC(Br)C(C)(C)C2)C1C |
| InChI | InChI=1S/C15H26BrNO2/c1-9-10(2)19-11(3)13(9)14(18)17-7-6-12(16)15(4,5)8-17/h9-13H,6-8H2,1-5H3 |
| InChIKey | HVRMQBMCJVDASB-UHFFFAOYSA-N |
| XLogP | 3.07 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.28 |
| LogP ≤ 5 | 3.07 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|