C12H16N2O5 — CID 112748987
2-[2-oxo-2-[[2-oxo-2-(propan-2-ylamino)ethyl]amino]ethyl]furan-3-carboxylic acid (PubChem CID 112748987) has the molecular formula C12H16N2O5 and a molecular weight of 268.27 g/mol. Its IUPAC name is 2-[2-oxo-2-[[2-oxo-2-(propan-2-ylamino)ethyl]amino]ethyl]furan-3-carboxylic acid.
| Compound Name | 2-[2-oxo-2-[[2-oxo-2-(propan-2-ylamino)ethyl]amino]ethyl]furan-3-carboxylic acid |
|---|---|
| PubChem CID | 112748987 |
| Molecular Formula | C12H16N2O5 |
| Molecular Weight | 268.27 g/mol |
| Exact Mass | 268.11 |
| IUPAC Name | 2-[2-oxo-2-[[2-oxo-2-(propan-2-ylamino)ethyl]amino]ethyl]furan-3-carboxylic acid |
| SMILES | CC(C)NC(=O)CNC(=O)Cc1occc1C(=O)O |
| InChI | InChI=1S/C12H16N2O5/c1-7(2)14-11(16)6-13-10(15)5-9-8(12(17)18)3-4-19-9/h3-4,7H,5-6H2,1-2H3,(H,13,15)(H,14,16)(H,17,18) |
| InChIKey | QEJODNSEFWCNAJ-UHFFFAOYSA-N |
| XLogP | 0.16 |
| TPSA | 108.64 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 268.27 |
| LogP ≤ 5 | 0.16 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |