C13H12N2O3 — CID 112749080
1-(4,6-dioxo-7H-furo[3,2-c]pyridin-5-yl)cyclopentane-1-carbonitrile (PubChem CID 112749080) has the molecular formula C13H12N2O3 and a molecular weight of 244.25 g/mol. Its IUPAC name is 1-(4,6-dioxo-7H-furo[3,2-c]pyridin-5-yl)cyclopentane-1-carbonitrile.
| Compound Name | 1-(4,6-dioxo-7H-furo[3,2-c]pyridin-5-yl)cyclopentane-1-carbonitrile |
|---|---|
| PubChem CID | 112749080 |
| Molecular Formula | C13H12N2O3 |
| Molecular Weight | 244.25 g/mol |
| Exact Mass | 244.08 |
| IUPAC Name | 1-(4,6-dioxo-7H-furo[3,2-c]pyridin-5-yl)cyclopentane-1-carbonitrile |
| SMILES | N#CC1(N2C(=O)Cc3occc3C2=O)CCCC1 |
| InChI | InChI=1S/C13H12N2O3/c14-8-13(4-1-2-5-13)15-11(16)7-10-9(12(15)17)3-6-18-10/h3,6H,1-2,4-5,7H2 |
| InChIKey | XSIOSQJZSMHMJU-UHFFFAOYSA-N |
| XLogP | 1.64 |
| TPSA | 74.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 244.25 |
| LogP ≤ 5 | 1.64 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|