C14H19ClO2S — CID 112749502
2-(3-chlorothiophen-2-yl)-1-(1-methoxycycloheptyl)ethanone (PubChem CID 112749502) has the molecular formula C14H19ClO2S and a molecular weight of 286.82 g/mol. Its IUPAC name is 2-(3-chlorothiophen-2-yl)-1-(1-methoxycycloheptyl)ethanone.
| Compound Name | 2-(3-chlorothiophen-2-yl)-1-(1-methoxycycloheptyl)ethanone |
|---|---|
| PubChem CID | 112749502 |
| Molecular Formula | C14H19ClO2S |
| Molecular Weight | 286.82 g/mol |
| Exact Mass | 286.08 |
| IUPAC Name | 2-(3-chlorothiophen-2-yl)-1-(1-methoxycycloheptyl)ethanone |
| SMILES | COC1(C(=O)Cc2sccc2Cl)CCCCCC1 |
| InChI | InChI=1S/C14H19ClO2S/c1-17-14(7-4-2-3-5-8-14)13(16)10-12-11(15)6-9-18-12/h6,9H,2-5,7-8,10H2,1H3 |
| InChIKey | VAUPJISZKPLZNE-UHFFFAOYSA-N |
| XLogP | 4.25 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 286.82 |
| LogP ≤ 5 | 4.25 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |