C11H14N4OS — CID 112750461
4-(1,4-oxazepan-4-yl)thieno[3,2-d]pyrimidin-2-amine (PubChem CID 112750461) has the molecular formula C11H14N4OS and a molecular weight of 250.33 g/mol. Its IUPAC name is 4-(1,4-oxazepan-4-yl)thieno[3,2-d]pyrimidin-2-amine.
| Compound Name | 4-(1,4-oxazepan-4-yl)thieno[3,2-d]pyrimidin-2-amine |
|---|---|
| PubChem CID | 112750461 |
| Molecular Formula | C11H14N4OS |
| Molecular Weight | 250.33 g/mol |
| Exact Mass | 250.09 |
| IUPAC Name | 4-(1,4-oxazepan-4-yl)thieno[3,2-d]pyrimidin-2-amine |
| SMILES | Nc1nc(N2CCCOCC2)c2sccc2n1 |
| InChI | InChI=1S/C11H14N4OS/c12-11-13-8-2-7-17-9(8)10(14-11)15-3-1-5-16-6-4-15/h2,7H,1,3-6H2,(H2,12,13,14) |
| InChIKey | PLPPPBIOYDDKFE-UHFFFAOYSA-N |
| XLogP | 1.50 |
| TPSA | 64.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 250.33 |
| LogP ≤ 5 | 1.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |