C11H11N7S — CID 112750723
2-hydrazinyl-N-(pyridazin-3-ylmethyl)thieno[3,2-d]pyrimidin-4-amine (PubChem CID 112750723) has the molecular formula C11H11N7S and a molecular weight of 273.32 g/mol. Its IUPAC name is 2-hydrazinyl-N-(pyridazin-3-ylmethyl)thieno[3,2-d]pyrimidin-4-amine.
| Compound Name | 2-hydrazinyl-N-(pyridazin-3-ylmethyl)thieno[3,2-d]pyrimidin-4-amine |
|---|---|
| PubChem CID | 112750723 |
| Molecular Formula | C11H11N7S |
| Molecular Weight | 273.32 g/mol |
| Exact Mass | 273.08 |
| IUPAC Name | 2-hydrazinyl-N-(pyridazin-3-ylmethyl)thieno[3,2-d]pyrimidin-4-amine |
| SMILES | NNc1nc(NCc2cccnn2)c2sccc2n1 |
| InChI | InChI=1S/C11H11N7S/c12-17-11-15-8-3-5-19-9(8)10(16-11)13-6-7-2-1-4-14-18-7/h1-5H,6,12H2,(H2,13,15,16,17) |
| InChIKey | JYQYNLXWICKYIL-UHFFFAOYSA-N |
| XLogP | 1.38 |
| TPSA | 101.64 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 273.32 |
| LogP ≤ 5 | 1.38 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|