C13H19N5S2 — CID 112750748
[4-(4-methylsulfanylazepan-1-yl)thieno[3,2-d]pyrimidin-2-yl]hydrazine (PubChem CID 112750748) has the molecular formula C13H19N5S2 and a molecular weight of 309.46 g/mol. Its IUPAC name is [4-(4-methylsulfanylazepan-1-yl)thieno[3,2-d]pyrimidin-2-yl]hydrazine.
| Compound Name | [4-(4-methylsulfanylazepan-1-yl)thieno[3,2-d]pyrimidin-2-yl]hydrazine |
|---|---|
| PubChem CID | 112750748 |
| Molecular Formula | C13H19N5S2 |
| Molecular Weight | 309.46 g/mol |
| Exact Mass | 309.11 |
| IUPAC Name | [4-(4-methylsulfanylazepan-1-yl)thieno[3,2-d]pyrimidin-2-yl]hydrazine |
| SMILES | CSC1CCCN(c2nc(NN)nc3ccsc23)CC1 |
| InChI | InChI=1S/C13H19N5S2/c1-19-9-3-2-6-18(7-4-9)12-11-10(5-8-20-11)15-13(16-12)17-14/h5,8-9H,2-4,6-7,14H2,1H3,(H,15,16,17) |
| InChIKey | MYELIECKXOORBA-UHFFFAOYSA-N |
| XLogP | 2.70 |
| TPSA | 67.07 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 309.46 |
| LogP ≤ 5 | 2.70 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|