About [3-(2-hydrazinylthieno[3,2-d]pyrimidin-4-yl)oxyphenyl]methanol
[3-(2-hydrazinylthieno[3,2-d]pyrimidin-4-yl)oxyphenyl]methanol (PubChem CID 112750775) has the molecular formula C13H12N4O2S
and a molecular weight of 288.33 g/mol. Its IUPAC name is [3-(2-hydrazinylthieno[3,2-d]pyrimidin-4-yl)oxyphenyl]methanol.
Molecular Properties
| Compound Name | [3-(2-hydrazinylthieno[3,2-d]pyrimidin-4-yl)oxyphenyl]methanol |
| PubChem CID | 112750775 |
| Molecular Formula | C13H12N4O2S |
| Molecular Weight | 288.33 g/mol |
| Exact Mass | 288.07 |
| IUPAC Name | [3-(2-hydrazinylthieno[3,2-d]pyrimidin-4-yl)oxyphenyl]methanol |
| SMILES | NNc1nc(Oc2cccc(CO)c2)c2sccc2n1 |
| InChI | InChI=1S/C13H12N4O2S/c14-17-13-15-10-4-5-20-11(10)12(16-13)19-9-3-1-2-8(6-9)7-18/h1-6,18H,7,14H2,(H,15,16,17) |
| InChIKey | VVHHYOCBRWVWPA-UHFFFAOYSA-N |
| XLogP | 2.26 |
| TPSA | 93.29 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 288.33 |
| LogP ≤ 5 | 2.26 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze [3-(2-hydrazinylthieno[3,2-d]pyrimidin-4-yl)oxyphenyl]methanol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [3-(2-hydrazinylthieno[3,2-d]pyrimidin-4-yl)oxyphenyl]methanol?
The IUPAC name of [3-(2-hydrazinylthieno[3,2-d]pyrimidin-4-yl)oxyphenyl]methanol (CID 112750775) is [3-(2-hydrazinylthieno[3,2-d]pyrimidin-4-yl)oxyphenyl]methanol.
What is the SMILES notation for [3-(2-hydrazinylthieno[3,2-d]pyrimidin-4-yl)oxyphenyl]methanol?
The canonical SMILES for [3-(2-hydrazinylthieno[3,2-d]pyrimidin-4-yl)oxyphenyl]methanol is NNc1nc(Oc2cccc(CO)c2)c2sccc2n1.
What is the InChIKey of [3-(2-hydrazinylthieno[3,2-d]pyrimidin-4-yl)oxyphenyl]methanol?
The InChIKey is VVHHYOCBRWVWPA-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H12N4O2S/c14-17-13-15-10-4-5-20-11(10)12(16-13)19-9-3-1-2-8(6-9)7-18/h1-6,18H,7,14H2,(H,15,16,17).
What are the key properties of [3-(2-hydrazinylthieno[3,2-d]pyrimidin-4-yl)oxyphenyl]methanol?
[3-(2-hydrazinylthieno[3,2-d]pyrimidin-4-yl)oxyphenyl]methanol has a molecular weight of 288.33 g/mol, XLogP of 2.26, 4 rotatable bonds, 3 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for [3-(2-hydrazinylthieno[3,2-d]pyrimidin-4-yl)oxyphenyl]methanol is sourced from PubChem (CID 112750775), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).