C10H8N6OS2 — CID 112750793
2-(2-hydrazinylthieno[3,2-d]pyrimidin-4-yl)sulfanyl-1H-pyrimidin-6-one (PubChem CID 112750793) has the molecular formula C10H8N6OS2 and a molecular weight of 292.35 g/mol. Its IUPAC name is 2-(2-hydrazinylthieno[3,2-d]pyrimidin-4-yl)sulfanyl-1H-pyrimidin-6-one.
| Compound Name | 2-(2-hydrazinylthieno[3,2-d]pyrimidin-4-yl)sulfanyl-1H-pyrimidin-6-one |
|---|---|
| PubChem CID | 112750793 |
| Molecular Formula | C10H8N6OS2 |
| Molecular Weight | 292.35 g/mol |
| Exact Mass | 292.02 |
| IUPAC Name | 2-(2-hydrazinylthieno[3,2-d]pyrimidin-4-yl)sulfanyl-1H-pyrimidin-6-one |
| SMILES | NNc1nc(Sc2nccc(=O)[nH]2)c2sccc2n1 |
| InChI | InChI=1S/C10H8N6OS2/c11-16-9-13-5-2-4-18-7(5)8(15-9)19-10-12-3-1-6(17)14-10/h1-4H,11H2,(H,12,14,17)(H,13,15,16) |
| InChIKey | ZKBCKRUQXASACK-UHFFFAOYSA-N |
| XLogP | 1.21 |
| TPSA | 109.58 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.35 |
| LogP ≤ 5 | 1.21 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|