C11H16 — CID 11275098
trans-(1R,2R)-1-ethenyl-2-[(1E,3Z)-hexa-1,3-dienyl]cyclopropane (PubChem CID 11275098) has the molecular formula C11H16 and a molecular weight of 148.25 g/mol. Its IUPAC name is trans-(1R,2R)-1-ethenyl-2-[(1E,3Z)-hexa-1,3-dienyl]cyclopropane.
| Compound Name | trans-(1R,2R)-1-ethenyl-2-[(1E,3Z)-hexa-1,3-dienyl]cyclopropane |
|---|---|
| PubChem CID | 11275098 |
| Molecular Formula | C11H16 |
| Molecular Weight | 148.25 g/mol |
| Exact Mass | 148.13 |
| IUPAC Name | trans-(1R,2R)-1-ethenyl-2-[(1E,3Z)-hexa-1,3-dienyl]cyclopropane |
| SMILES | C=C[C@H]1C[C@@H]1/C=C/C=C\CC |
| InChI | InChI=1S/C11H16/c1-3-5-6-7-8-11-9-10(11)4-2/h4-8,10-11H,2-3,9H2,1H3/b6-5-,8-7+/t10-,11-/m0/s1 |
| InChIKey | IUJUNEVKAIOLIM-LHBSJXCKSA-N |
| XLogP | 3.33 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 4 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 148.25 |
| LogP ≤ 5 | 3.33 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|