2-aminoethanol;2-hydroxypropanoic acid

C5H13NO4 — CID 11275112

IUPAC2-aminoethanol;2-hydroxypropanoic acid
SMILESCC(O)C(=O)O.NCCO
InChIInChI=1S/C3H6O3.C2H7NO/c1-2(4)3(5)6;3-1-2-4/h2,4H,1H3,(H,5,6);4H,1-3H2
InChIKeyNEQXUPRFDXNNTA-UHFFFAOYSA-N
MW151.16 g/mol
LogP-1.61
Rot. Bonds2

About 2-aminoethanol;2-hydroxypropanoic acid

2-aminoethanol;2-hydroxypropanoic acid (PubChem CID 11275112) has the molecular formula C5H13NO4 and a molecular weight of 151.16 g/mol. Its IUPAC name is 2-aminoethanol;2-hydroxypropanoic acid.

Molecular Properties

Compound Name2-aminoethanol;2-hydroxypropanoic acid
PubChem CID11275112
Molecular FormulaC5H13NO4
Molecular Weight151.16 g/mol
Exact Mass151.08
IUPAC Name2-aminoethanol;2-hydroxypropanoic acid
SMILESCC(O)C(=O)O.NCCO
InChIInChI=1S/C3H6O3.C2H7NO/c1-2(4)3(5)6;3-1-2-4/h2,4H,1H3,(H,5,6);4H,1-3H2
InChIKeyNEQXUPRFDXNNTA-UHFFFAOYSA-N
XLogP-1.61
TPSA103.78 Ų
H-Bond Donors4
H-Bond Acceptors4
Rotatable Bonds2
Heavy Atoms10
Complexity—

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500151.16
LogP ≤ 5-1.61
H-Bond Donors ≤ 54
H-Bond Acceptors ≤ 104

Analyze 2-aminoethanol;2-hydroxypropanoic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 2-aminoethanol;2-hydroxypropanoic acid?
The IUPAC name of 2-aminoethanol;2-hydroxypropanoic acid (CID 11275112) is 2-aminoethanol;2-hydroxypropanoic acid.
What is the SMILES notation for 2-aminoethanol;2-hydroxypropanoic acid?
The canonical SMILES for 2-aminoethanol;2-hydroxypropanoic acid is CC(O)C(=O)O.NCCO.
What is the InChIKey of 2-aminoethanol;2-hydroxypropanoic acid?
The InChIKey is NEQXUPRFDXNNTA-UHFFFAOYSA-N. The full InChI is InChI=1S/C3H6O3.C2H7NO/c1-2(4)3(5)6;3-1-2-4/h2,4H,1H3,(H,5,6);4H,1-3H2.
What are the key properties of 2-aminoethanol;2-hydroxypropanoic acid?
2-aminoethanol;2-hydroxypropanoic acid has a molecular weight of 151.16 g/mol, XLogP of -1.61, 2 rotatable bonds, 4 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-aminoethanol;2-hydroxypropanoic acid is sourced from PubChem (CID 11275112), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).