About 2-[(6-amino-1-oxo-2,3-dihydroisoindol-5-yl)sulfanyl]-N,N-dimethylacetamide
2-[(6-amino-1-oxo-2,3-dihydroisoindol-5-yl)sulfanyl]-N,N-dimethylacetamide (PubChem CID 112751730) has the molecular formula C12H15N3O2S
and a molecular weight of 265.34 g/mol. Its IUPAC name is 2-[(6-amino-1-oxo-2,3-dihydroisoindol-5-yl)sulfanyl]-N,N-dimethylacetamide.
Molecular Properties
| Compound Name | 2-[(6-amino-1-oxo-2,3-dihydroisoindol-5-yl)sulfanyl]-N,N-dimethylacetamide |
| PubChem CID | 112751730 |
| Molecular Formula | C12H15N3O2S |
| Molecular Weight | 265.34 g/mol |
| Exact Mass | 265.09 |
| IUPAC Name | 2-[(6-amino-1-oxo-2,3-dihydroisoindol-5-yl)sulfanyl]-N,N-dimethylacetamide |
| SMILES | CN(C)C(=O)CSc1cc2c(cc1N)C(=O)NC2 |
| InChI | InChI=1S/C12H15N3O2S/c1-15(2)11(16)6-18-10-3-7-5-14-12(17)8(7)4-9(10)13/h3-4H,5-6,13H2,1-2H3,(H,14,17) |
| InChIKey | CMSWPGIOKIRYNF-UHFFFAOYSA-N |
| XLogP | 0.69 |
| TPSA | 75.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 265.34 |
| LogP ≤ 5 | 0.69 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|
Analyze 2-[(6-amino-1-oxo-2,3-dihydroisoindol-5-yl)sulfanyl]-N,N-dimethylacetamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[(6-amino-1-oxo-2,3-dihydroisoindol-5-yl)sulfanyl]-N,N-dimethylacetamide?
The IUPAC name of 2-[(6-amino-1-oxo-2,3-dihydroisoindol-5-yl)sulfanyl]-N,N-dimethylacetamide (CID 112751730) is 2-[(6-amino-1-oxo-2,3-dihydroisoindol-5-yl)sulfanyl]-N,N-dimethylacetamide.
What is the SMILES notation for 2-[(6-amino-1-oxo-2,3-dihydroisoindol-5-yl)sulfanyl]-N,N-dimethylacetamide?
The canonical SMILES for 2-[(6-amino-1-oxo-2,3-dihydroisoindol-5-yl)sulfanyl]-N,N-dimethylacetamide is CN(C)C(=O)CSc1cc2c(cc1N)C(=O)NC2.
What is the InChIKey of 2-[(6-amino-1-oxo-2,3-dihydroisoindol-5-yl)sulfanyl]-N,N-dimethylacetamide?
The InChIKey is CMSWPGIOKIRYNF-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H15N3O2S/c1-15(2)11(16)6-18-10-3-7-5-14-12(17)8(7)4-9(10)13/h3-4H,5-6,13H2,1-2H3,(H,14,17).
What are the key properties of 2-[(6-amino-1-oxo-2,3-dihydroisoindol-5-yl)sulfanyl]-N,N-dimethylacetamide?
2-[(6-amino-1-oxo-2,3-dihydroisoindol-5-yl)sulfanyl]-N,N-dimethylacetamide has a molecular weight of 265.34 g/mol, XLogP of 0.69, 3 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[(6-amino-1-oxo-2,3-dihydroisoindol-5-yl)sulfanyl]-N,N-dimethylacetamide is sourced from PubChem (CID 112751730), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).