C13H19F2N3 — CID 112751838
1-(2-amino-4,5-difluorophenyl)-N,N,4-trimethylpyrrolidin-3-amine (PubChem CID 112751838) has the molecular formula C13H19F2N3 and a molecular weight of 255.31 g/mol. Its IUPAC name is 1-(2-amino-4,5-difluorophenyl)-N,N,4-trimethylpyrrolidin-3-amine.
| Compound Name | 1-(2-amino-4,5-difluorophenyl)-N,N,4-trimethylpyrrolidin-3-amine |
|---|---|
| PubChem CID | 112751838 |
| Molecular Formula | C13H19F2N3 |
| Molecular Weight | 255.31 g/mol |
| Exact Mass | 255.15 |
| IUPAC Name | 1-(2-amino-4,5-difluorophenyl)-N,N,4-trimethylpyrrolidin-3-amine |
| SMILES | CC1CN(c2cc(F)c(F)cc2N)CC1N(C)C |
| InChI | InChI=1S/C13H19F2N3/c1-8-6-18(7-13(8)17(2)3)12-5-10(15)9(14)4-11(12)16/h4-5,8,13H,6-7,16H2,1-3H3 |
| InChIKey | ARFCIOGIPQSONJ-UHFFFAOYSA-N |
| XLogP | 1.93 |
| TPSA | 32.50 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 255.31 |
| LogP ≤ 5 | 1.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|