C14H20F2N2 — CID 112751845
2-(2-ethylazepan-1-yl)-4,5-difluoroaniline (PubChem CID 112751845) has the molecular formula C14H20F2N2 and a molecular weight of 254.32 g/mol. Its IUPAC name is 2-(2-ethylazepan-1-yl)-4,5-difluoroaniline.
| Compound Name | 2-(2-ethylazepan-1-yl)-4,5-difluoroaniline |
|---|---|
| PubChem CID | 112751845 |
| Molecular Formula | C14H20F2N2 |
| Molecular Weight | 254.32 g/mol |
| Exact Mass | 254.16 |
| IUPAC Name | 2-(2-ethylazepan-1-yl)-4,5-difluoroaniline |
| SMILES | CCC1CCCCCN1c1cc(F)c(F)cc1N |
| InChI | InChI=1S/C14H20F2N2/c1-2-10-6-4-3-5-7-18(10)14-9-12(16)11(15)8-13(14)17/h8-10H,2-7,17H2,1H3 |
| InChIKey | NWRWKMJATFRMBT-UHFFFAOYSA-N |
| XLogP | 3.71 |
| TPSA | 29.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 254.32 |
| LogP ≤ 5 | 3.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|