C5H8O4S — CID 11275189
(3aR,6aS)-4,5,6,6a-tetrahydro-3aH-cyclopenta[d][1,3,2]dioxathiole 2,2-dioxide (PubChem CID 11275189) has the molecular formula C5H8O4S and a molecular weight of 164.18 g/mol. Its IUPAC name is (3aR,6aS)-4,5,6,6a-tetrahydro-3aH-cyclopenta[d][1,3,2]dioxathiole 2,2-dioxide.
| Compound Name | (3aR,6aS)-4,5,6,6a-tetrahydro-3aH-cyclopenta[d][1,3,2]dioxathiole 2,2-dioxide |
|---|---|
| PubChem CID | 11275189 |
| Molecular Formula | C5H8O4S |
| Molecular Weight | 164.18 g/mol |
| Exact Mass | 164.01 |
| IUPAC Name | (3aR,6aS)-4,5,6,6a-tetrahydro-3aH-cyclopenta[d][1,3,2]dioxathiole 2,2-dioxide |
| SMILES | O=S1(=O)O[C@H]2CCC[C@H]2O1 |
| InChI | InChI=1S/C5H8O4S/c6-10(7)8-4-2-1-3-5(4)9-10/h4-5H,1-3H2/t4-,5+ |
| InChIKey | FKWFSTCVZZHRCG-SYDPRGILSA-N |
| XLogP | 0.20 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 164.18 |
| LogP ≤ 5 | 0.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |