C10H24N4O2S — CID 112752098
N-[2-(5-ethyl-1,1-dioxo-1,2,5-thiadiazolidin-2-yl)ethyl]-N',N'-dimethylethane-1,2-diamine (PubChem CID 112752098) has the molecular formula C10H24N4O2S and a molecular weight of 264.39 g/mol. Its IUPAC name is N-[2-(5-ethyl-1,1-dioxo-1,2,5-thiadiazolidin-2-yl)ethyl]-N',N'-dimethylethane-1,2-diamine.
| Compound Name | N-[2-(5-ethyl-1,1-dioxo-1,2,5-thiadiazolidin-2-yl)ethyl]-N',N'-dimethylethane-1,2-diamine |
|---|---|
| PubChem CID | 112752098 |
| Molecular Formula | C10H24N4O2S |
| Molecular Weight | 264.39 g/mol |
| Exact Mass | 264.16 |
| IUPAC Name | N-[2-(5-ethyl-1,1-dioxo-1,2,5-thiadiazolidin-2-yl)ethyl]-N',N'-dimethylethane-1,2-diamine |
| SMILES | CCN1CCN(CCNCCN(C)C)S1(=O)=O |
| InChI | InChI=1S/C10H24N4O2S/c1-4-13-9-10-14(17(13,15)16)8-6-11-5-7-12(2)3/h11H,4-10H2,1-3H3 |
| InChIKey | PWNIPCZACHLYSI-UHFFFAOYSA-N |
| XLogP | -0.98 |
| TPSA | 55.89 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 264.39 |
| LogP ≤ 5 | -0.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|