C10H23N3O3S — CID 112752101
N-[2-(5-ethyl-1,1-dioxo-1,2,5-thiadiazolidin-2-yl)ethyl]-3-methoxypropan-1-amine (PubChem CID 112752101) has the molecular formula C10H23N3O3S and a molecular weight of 265.38 g/mol. Its IUPAC name is N-[2-(5-ethyl-1,1-dioxo-1,2,5-thiadiazolidin-2-yl)ethyl]-3-methoxypropan-1-amine.
| Compound Name | N-[2-(5-ethyl-1,1-dioxo-1,2,5-thiadiazolidin-2-yl)ethyl]-3-methoxypropan-1-amine |
|---|---|
| PubChem CID | 112752101 |
| Molecular Formula | C10H23N3O3S |
| Molecular Weight | 265.38 g/mol |
| Exact Mass | 265.15 |
| IUPAC Name | N-[2-(5-ethyl-1,1-dioxo-1,2,5-thiadiazolidin-2-yl)ethyl]-3-methoxypropan-1-amine |
| SMILES | CCN1CCN(CCNCCCOC)S1(=O)=O |
| InChI | InChI=1S/C10H23N3O3S/c1-3-12-8-9-13(17(12,14)15)7-6-11-5-4-10-16-2/h11H,3-10H2,1-2H3 |
| InChIKey | QHBFMFZWRXQLEV-UHFFFAOYSA-N |
| XLogP | -0.51 |
| TPSA | 61.88 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 265.38 |
| LogP ≤ 5 | -0.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|