C11H25N3O3S — CID 112752107
N-[2-(1,1-dioxo-5-propyl-1,2,5-thiadiazolidin-2-yl)ethyl]-3-methoxypropan-1-amine (PubChem CID 112752107) has the molecular formula C11H25N3O3S and a molecular weight of 279.41 g/mol. Its IUPAC name is N-[2-(1,1-dioxo-5-propyl-1,2,5-thiadiazolidin-2-yl)ethyl]-3-methoxypropan-1-amine.
| Compound Name | N-[2-(1,1-dioxo-5-propyl-1,2,5-thiadiazolidin-2-yl)ethyl]-3-methoxypropan-1-amine |
|---|---|
| PubChem CID | 112752107 |
| Molecular Formula | C11H25N3O3S |
| Molecular Weight | 279.41 g/mol |
| Exact Mass | 279.16 |
| IUPAC Name | N-[2-(1,1-dioxo-5-propyl-1,2,5-thiadiazolidin-2-yl)ethyl]-3-methoxypropan-1-amine |
| SMILES | CCCN1CCN(CCNCCCOC)S1(=O)=O |
| InChI | InChI=1S/C11H25N3O3S/c1-3-7-13-9-10-14(18(13,15)16)8-6-12-5-4-11-17-2/h12H,3-11H2,1-2H3 |
| InChIKey | BVPFAVXWMROODT-UHFFFAOYSA-N |
| XLogP | -0.12 |
| TPSA | 61.88 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 279.41 |
| LogP ≤ 5 | -0.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|