C11H22N2O2S2 — CID 112752133
[1-[(1,1-dioxo-5-propyl-1,2,5-thiadiazolidin-2-yl)methyl]cyclobutyl]methanethiol (PubChem CID 112752133) has the molecular formula C11H22N2O2S2 and a molecular weight of 278.44 g/mol. Its IUPAC name is [1-[(1,1-dioxo-5-propyl-1,2,5-thiadiazolidin-2-yl)methyl]cyclobutyl]methanethiol.
| Compound Name | [1-[(1,1-dioxo-5-propyl-1,2,5-thiadiazolidin-2-yl)methyl]cyclobutyl]methanethiol |
|---|---|
| PubChem CID | 112752133 |
| Molecular Formula | C11H22N2O2S2 |
| Molecular Weight | 278.44 g/mol |
| Exact Mass | 278.11 |
| IUPAC Name | [1-[(1,1-dioxo-5-propyl-1,2,5-thiadiazolidin-2-yl)methyl]cyclobutyl]methanethiol |
| SMILES | CCCN1CCN(CC2(CS)CCC2)S1(=O)=O |
| InChI | InChI=1S/C11H22N2O2S2/c1-2-6-12-7-8-13(17(12,14)15)9-11(10-16)4-3-5-11/h16H,2-10H2,1H3 |
| InChIKey | WFVDXIFRAXPWSZ-UHFFFAOYSA-N |
| XLogP | 1.36 |
| TPSA | 40.62 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 278.44 |
| LogP ≤ 5 | 1.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|