C12H16N4O3 — CID 112752300
methyl 4-(3-cyano-1,2,4-triazol-1-yl)-2,2-diethyl-3-oxobutanoate (PubChem CID 112752300) has the molecular formula C12H16N4O3 and a molecular weight of 264.28 g/mol. Its IUPAC name is methyl 4-(3-cyano-1,2,4-triazol-1-yl)-2,2-diethyl-3-oxobutanoate.
| Compound Name | methyl 4-(3-cyano-1,2,4-triazol-1-yl)-2,2-diethyl-3-oxobutanoate |
|---|---|
| PubChem CID | 112752300 |
| Molecular Formula | C12H16N4O3 |
| Molecular Weight | 264.28 g/mol |
| Exact Mass | 264.12 |
| IUPAC Name | methyl 4-(3-cyano-1,2,4-triazol-1-yl)-2,2-diethyl-3-oxobutanoate |
| SMILES | CCC(CC)(C(=O)Cn1cnc(C#N)n1)C(=O)OC |
| InChI | InChI=1S/C12H16N4O3/c1-4-12(5-2,11(18)19-3)9(17)7-16-8-14-10(6-13)15-16/h8H,4-5,7H2,1-3H3 |
| InChIKey | XDZXPQFAZVYPIB-UHFFFAOYSA-N |
| XLogP | 0.70 |
| TPSA | 97.87 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 264.28 |
| LogP ≤ 5 | 0.70 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|