C12H22N2O3 — CID 112753360
4-hydroxy-N-[4-(hydroxymethyl)cyclohexyl]pyrrolidine-2-carboxamide (PubChem CID 112753360) has the molecular formula C12H22N2O3 and a molecular weight of 242.32 g/mol. Its IUPAC name is 4-hydroxy-N-[4-(hydroxymethyl)cyclohexyl]pyrrolidine-2-carboxamide.
| Compound Name | 4-hydroxy-N-[4-(hydroxymethyl)cyclohexyl]pyrrolidine-2-carboxamide |
|---|---|
| PubChem CID | 112753360 |
| Molecular Formula | C12H22N2O3 |
| Molecular Weight | 242.32 g/mol |
| Exact Mass | 242.16 |
| IUPAC Name | 4-hydroxy-N-[4-(hydroxymethyl)cyclohexyl]pyrrolidine-2-carboxamide |
| SMILES | O=C(NC1CCC(CO)CC1)C1CC(O)CN1 |
| InChI | InChI=1S/C12H22N2O3/c15-7-8-1-3-9(4-2-8)14-12(17)11-5-10(16)6-13-11/h8-11,13,15-16H,1-7H2,(H,14,17) |
| InChIKey | PHRXOQMVYAYAJL-UHFFFAOYSA-N |
| XLogP | -0.62 |
| TPSA | 81.59 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 242.32 |
| LogP ≤ 5 | -0.62 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |